C12H24O2 — CID 59036346
(3S,4R,5R,6S)-2-[[deuterio(tritio)methoxy]methyl]-6-ethyl-3,4,5-trimethyloxane (PubChem CID 59036346) has the molecular formula C12H24O2 and a molecular weight of 203.34 g/mol. Its IUPAC name is (3S,4R,5R,6S)-2-[[deuterio(tritio)methoxy]methyl]-6-ethyl-3,4,5-trimethyloxane.
| Compound Name | (3S,4R,5R,6S)-2-[[deuterio(tritio)methoxy]methyl]-6-ethyl-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 59036346 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 203.34 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | (3S,4R,5R,6S)-2-[[deuterio(tritio)methoxy]methyl]-6-ethyl-3,4,5-trimethyloxane |
| SMILES | [2H]C([3H])OCC1O[C@@H](CC)[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C12H24O2/c1-6-11-9(3)8(2)10(4)12(14-11)7-13-5/h8-12H,6-7H2,1-5H3/t8-,9-,10+,11+,12?/m1/s1/i5TD/t5?,8-,9-,10+,11+,12? |
| InChIKey | QGRGORCBNBBMLS-PTJYIOHBSA-N |
| XLogP | 2.72 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |