C9H18O2 — CID 21349670
2-(methoxymethyl)-3,4,5-trimethyloxolane (PubChem CID 21349670) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-(methoxymethyl)-3,4,5-trimethyloxolane.
| Compound Name | 2-(methoxymethyl)-3,4,5-trimethyloxolane |
|---|---|
| PubChem CID | 21349670 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 2-(methoxymethyl)-3,4,5-trimethyloxolane |
| SMILES | COCC1OC(C)C(C)C1C |
| InChI | InChI=1S/C9H18O2/c1-6-7(2)9(5-10-4)11-8(6)3/h6-9H,5H2,1-4H3 |
| InChIKey | XQMLREYHDMAELA-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |