C11H21N3O2 — CID 59036365
(2S,3R,4R,5S,6S)-2-(azidomethyl)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane (PubChem CID 59036365) has the molecular formula C11H21N3O2 and a molecular weight of 230.32 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-(azidomethyl)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane.
| Compound Name | (2S,3R,4R,5S,6S)-2-(azidomethyl)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane |
|---|---|
| PubChem CID | 59036365 |
| Molecular Formula | C11H21N3O2 |
| Molecular Weight | 230.32 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-(azidomethyl)-6-[[deuterio(tritio)methoxy]methyl]-3,4,5-trimethyloxane |
| SMILES | [2H]C([3H])OC[C@H]1O[C@H](CN=[N+]=[N-])[C@H](C)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H21N3O2/c1-7-8(2)10(5-13-14-12)16-11(6-15-4)9(7)3/h7-11H,5-6H2,1-4H3/t7-,8-,9+,10-,11-/m1/s1/i4TD/t4?,7-,8-,9+,10-,11- |
| InChIKey | KQAGWIMDNNWZKG-OPGBKRKOSA-N |
| XLogP | 2.62 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|