C19H38N3O5S2- — CID 160756304
(3S,4R,6S)-2-(azidomethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol;carbanide;(3S,4R,6S)-2-(hydroxymethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol (PubChem CID 160756304) has the molecular formula C19H38N3O5S2- and a molecular weight of 452.66 g/mol. Its IUPAC name is (3S,4R,6S)-2-(azidomethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol;carbanide;(3S,4R,6S)-2-(hydroxymethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol.
| Compound Name | (3S,4R,6S)-2-(azidomethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol;carbanide;(3S,4R,6S)-2-(hydroxymethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol |
|---|---|
| PubChem CID | 160756304 |
| Molecular Formula | C19H38N3O5S2- |
| Molecular Weight | 452.66 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | (3S,4R,6S)-2-(azidomethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol;carbanide;(3S,4R,6S)-2-(hydroxymethyl)-4,5-dimethyl-6-methylsulfanyloxan-3-ol |
| SMILES | CS[C@@H]1OC(CN=[N+]=[N-])[C@@H](O)[C@H](C)C1C.CS[C@@H]1OC(CO)[C@@H](O)[C@H](C)C1C.[CH3-] |
| InChI | InChI=1S/C9H17N3O2S.C9H18O3S.CH3/c1-5-6(2)9(15-3)14-7(8(5)13)4-11-12-10;1-5-6(2)9(13-3)12-7(4-10)8(5)11;/h5-9,13H,4H2,1-3H3;5-11H,4H2,1-3H3;1H3/q;;-1/t2*5-,6?,7?,8+,9+;/m11./s1 |
| InChIKey | RXMBVLBSRPAZKP-XQBALKFUSA-N |
| XLogP | 3.17 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.66 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|