C10H20O2S — CID 20660413
(3,4,5-trimethyl-6-methylsulfanyloxan-2-yl)methanol (PubChem CID 20660413) has the molecular formula C10H20O2S and a molecular weight of 204.33 g/mol. Its IUPAC name is (3,4,5-trimethyl-6-methylsulfanyloxan-2-yl)methanol.
| Compound Name | (3,4,5-trimethyl-6-methylsulfanyloxan-2-yl)methanol |
|---|---|
| PubChem CID | 20660413 |
| Molecular Formula | C10H20O2S |
| Molecular Weight | 204.33 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3,4,5-trimethyl-6-methylsulfanyloxan-2-yl)methanol |
| SMILES | CSC1OC(CO)C(C)C(C)C1C |
| InChI | InChI=1S/C10H20O2S/c1-6-7(2)9(5-11)12-10(13-4)8(6)3/h6-11H,5H2,1-4H3 |
| InChIKey | BNMLEGNUQDQKFZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.33 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |