C12H24O2 — CID 59651572
[(2S,3S,4R,5R,6S)-3,4,5-trimethyl-6-propan-2-yloxan-2-yl]methanol (PubChem CID 59651572) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6S)-3,4,5-trimethyl-6-propan-2-yloxan-2-yl]methanol.
| Compound Name | [(2S,3S,4R,5R,6S)-3,4,5-trimethyl-6-propan-2-yloxan-2-yl]methanol |
|---|---|
| PubChem CID | 59651572 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | [(2S,3S,4R,5R,6S)-3,4,5-trimethyl-6-propan-2-yloxan-2-yl]methanol |
| SMILES | CC(C)[C@@H]1O[C@H](CO)[C@@H](C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C12H24O2/c1-7(2)12-10(5)8(3)9(4)11(6-13)14-12/h7-13H,6H2,1-5H3/t8-,9-,10+,11+,12-/m0/s1 |
| InChIKey | UFMAMDQAMNZZBH-HGCLJGPKSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |