C11H21O2Y- — CID 146746117
[(3S,4R,6R)-3,4-dimethyl-6-propan-2-yl-3,4,5,6-tetrahydro-2H-pyran-5-id-2-yl]methanol;yttrium (PubChem CID 146746117) has the molecular formula C11H21O2Y- and a molecular weight of 274.19 g/mol. Its IUPAC name is [(3S,4R,6R)-3,4-dimethyl-6-propan-2-yl-3,4,5,6-tetrahydro-2H-pyran-5-id-2-yl]methanol;yttrium.
| Compound Name | [(3S,4R,6R)-3,4-dimethyl-6-propan-2-yl-3,4,5,6-tetrahydro-2H-pyran-5-id-2-yl]methanol;yttrium |
|---|---|
| PubChem CID | 146746117 |
| Molecular Formula | C11H21O2Y- |
| Molecular Weight | 274.19 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | [(3S,4R,6R)-3,4-dimethyl-6-propan-2-yl-3,4,5,6-tetrahydro-2H-pyran-5-id-2-yl]methanol;yttrium |
| SMILES | CC(C)[C@H]1[CH-][C@@H](C)[C@H](C)C(CO)O1.[Y] |
| InChI | InChI=1S/C11H21O2.Y/c1-7(2)10-5-8(3)9(4)11(6-12)13-10;/h5,7-12H,6H2,1-4H3;/q-1;/t8-,9+,10-,11?;/m1./s1 |
| InChIKey | PJJHGUNVAZOTAG-HVTMUDBSSA-N |
| XLogP | 1.88 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.19 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|