C7H13FO2 — CID 76558929
(4-fluoro-3,5-dimethyloxolan-2-yl)methanol (PubChem CID 76558929) has the molecular formula C7H13FO2 and a molecular weight of 148.18 g/mol. Its IUPAC name is (4-fluoro-3,5-dimethyloxolan-2-yl)methanol.
| Compound Name | (4-fluoro-3,5-dimethyloxolan-2-yl)methanol |
|---|---|
| PubChem CID | 76558929 |
| Molecular Formula | C7H13FO2 |
| Molecular Weight | 148.18 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | (4-fluoro-3,5-dimethyloxolan-2-yl)methanol |
| SMILES | CC1OC(CO)C(C)C1F |
| InChI | InChI=1S/C7H13FO2/c1-4-6(3-9)10-5(2)7(4)8/h4-7,9H,3H2,1-2H3 |
| InChIKey | BNYMPPGGVCXUIC-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |