C8H14N4O5 — CID 155589487
N-[(3R,4R,5R,6R)-6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]-2-deuterioacetamide (PubChem CID 155589487) has the molecular formula C8H14N4O5 and a molecular weight of 247.23 g/mol. Its IUPAC name is N-[(3R,4R,5R,6R)-6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]-2-deuterioacetamide.
| Compound Name | N-[(3R,4R,5R,6R)-6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]-2-deuterioacetamide |
|---|---|
| PubChem CID | 155589487 |
| Molecular Formula | C8H14N4O5 |
| Molecular Weight | 247.23 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | N-[(3R,4R,5R,6R)-6-(azidomethyl)-2,4,5-trihydroxyoxan-3-yl]-2-deuterioacetamide |
| SMILES | [2H]CC(=O)N[C@H]1C(O)O[C@H](CN=[N+]=[N-])[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C8H14N4O5/c1-3(13)11-5-7(15)6(14)4(2-10-12-9)17-8(5)16/h4-8,14-16H,2H2,1H3,(H,11,13)/t4-,5-,6+,7-,8?/m1/s1/i1D |
| InChIKey | JBCJECOTKGFRTM-VROAPGSBSA-N |
| XLogP | -1.76 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.23 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|