C10H20O3 — CID 59036539
[(2R,3R,4R,5R)-6-[deuterio(tritio)methoxy]-3,4,5-trimethyloxan-2-yl]methanol (PubChem CID 59036539) has the molecular formula C10H20O3 and a molecular weight of 191.28 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-6-[deuterio(tritio)methoxy]-3,4,5-trimethyloxan-2-yl]methanol.
| Compound Name | [(2R,3R,4R,5R)-6-[deuterio(tritio)methoxy]-3,4,5-trimethyloxan-2-yl]methanol |
|---|---|
| PubChem CID | 59036539 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.16 |
| IUPAC Name | [(2R,3R,4R,5R)-6-[deuterio(tritio)methoxy]-3,4,5-trimethyloxan-2-yl]methanol |
| SMILES | [2H]C([3H])OC1O[C@@H](CO)[C@H](C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C10H20O3/c1-6-7(2)9(5-11)13-10(12-4)8(6)3/h6-11H,5H2,1-4H3/t6-,7-,8-,9+,10?/m1/s1/i4TD/t4?,6-,7-,8-,9+,10? |
| InChIKey | QVVRVECFJFSYTN-YEFWMDCMSA-N |
| XLogP | 1.26 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |