C10H19NO4 — CID 59036331
(3R,4R,5R,6R)-2-[deuterio(tritio)methoxy]-3,4,5-trimethyl-6-(nitromethyl)oxane (PubChem CID 59036331) has the molecular formula C10H19NO4 and a molecular weight of 220.28 g/mol. Its IUPAC name is (3R,4R,5R,6R)-2-[deuterio(tritio)methoxy]-3,4,5-trimethyl-6-(nitromethyl)oxane.
| Compound Name | (3R,4R,5R,6R)-2-[deuterio(tritio)methoxy]-3,4,5-trimethyl-6-(nitromethyl)oxane |
|---|---|
| PubChem CID | 59036331 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 220.28 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | (3R,4R,5R,6R)-2-[deuterio(tritio)methoxy]-3,4,5-trimethyl-6-(nitromethyl)oxane |
| SMILES | [2H]C([3H])OC1O[C@@H](C[N+](=O)[O-])[C@H](C)[C@@H](C)[C@H]1C |
| InChI | InChI=1S/C10H19NO4/c1-6-7(2)9(5-11(12)13)15-10(14-4)8(6)3/h6-10H,5H2,1-4H3/t6-,7-,8-,9+,10?/m1/s1/i4TD/t4?,6-,7-,8-,9+,10? |
| InChIKey | TYDSLMYDYXBZPN-YEFWMDCMSA-N |
| XLogP | 1.54 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|