C18H34O4 — CID 126608883
(2S,4S,5S)-2-methoxy-3,4,5-trimethyl-6-[[(2S,5R)-4,5,6-trimethyloxan-2-yl]oxymethyl]oxane (PubChem CID 126608883) has the molecular formula C18H34O4 and a molecular weight of 314.47 g/mol. Its IUPAC name is (2S,4S,5S)-2-methoxy-3,4,5-trimethyl-6-[[(2S,5R)-4,5,6-trimethyloxan-2-yl]oxymethyl]oxane.
| Compound Name | (2S,4S,5S)-2-methoxy-3,4,5-trimethyl-6-[[(2S,5R)-4,5,6-trimethyloxan-2-yl]oxymethyl]oxane |
|---|---|
| PubChem CID | 126608883 |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.47 g/mol |
| Exact Mass | 314.25 |
| IUPAC Name | (2S,4S,5S)-2-methoxy-3,4,5-trimethyl-6-[[(2S,5R)-4,5,6-trimethyloxan-2-yl]oxymethyl]oxane |
| SMILES | CO[C@H]1OC(CO[C@@H]2CC(C)[C@@H](C)C(C)O2)[C@@H](C)[C@H](C)C1C |
| InChI | InChI=1S/C18H34O4/c1-10-8-17(21-15(6)11(10)2)20-9-16-13(4)12(3)14(5)18(19-7)22-16/h10-18H,8-9H2,1-7H3/t10?,11-,12+,13+,14?,15?,16?,17+,18+/m1/s1 |
| InChIKey | DNBUGBYHGRRPRU-LHDLIDGGSA-N |
| XLogP | 3.69 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.47 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |