C10H20O2 — CID 58651620
(3R,4R,6R)-6-ethoxy-2,3,4-trimethyloxane (PubChem CID 58651620) has the molecular formula C10H20O2 and a molecular weight of 172.27 g/mol. Its IUPAC name is (3R,4R,6R)-6-ethoxy-2,3,4-trimethyloxane.
| Compound Name | (3R,4R,6R)-6-ethoxy-2,3,4-trimethyloxane |
|---|---|
| PubChem CID | 58651620 |
| Molecular Formula | C10H20O2 |
| Molecular Weight | 172.27 g/mol |
| Exact Mass | 172.15 |
| IUPAC Name | (3R,4R,6R)-6-ethoxy-2,3,4-trimethyloxane |
| SMILES | CCO[C@H]1C[C@@H](C)[C@@H](C)C(C)O1 |
| InChI | InChI=1S/C10H20O2/c1-5-11-10-6-7(2)8(3)9(4)12-10/h7-10H,5-6H2,1-4H3/t7-,8-,9?,10-/m1/s1 |
| InChIKey | ODKQNYDVLVDOMP-XKSJUCENSA-N |
| XLogP | 2.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.27 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |