C9H18O — CID 20816370
2,3,4,6-tetramethyloxane (PubChem CID 20816370) has the molecular formula C9H18O and a molecular weight of 142.24 g/mol. Its IUPAC name is 2,3,4,6-tetramethyloxane.
| Compound Name | 2,3,4,6-tetramethyloxane |
|---|---|
| PubChem CID | 20816370 |
| Molecular Formula | C9H18O |
| Molecular Weight | 142.24 g/mol |
| Exact Mass | 142.14 |
| IUPAC Name | 2,3,4,6-tetramethyloxane |
| SMILES | CC1CC(C)C(C)C(C)O1 |
| InChI | InChI=1S/C9H18O/c1-6-5-7(2)10-9(4)8(6)3/h6-9H,5H2,1-4H3 |
| InChIKey | ZHZYTXSSPUQACZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.24 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |