C10H21NO — CID 143366374
(3R,4S,6R)-N,N,2,3,6-pentamethyloxan-4-amine (PubChem CID 143366374) has the molecular formula C10H21NO and a molecular weight of 171.28 g/mol. Its IUPAC name is (3R,4S,6R)-N,N,2,3,6-pentamethyloxan-4-amine.
| Compound Name | (3R,4S,6R)-N,N,2,3,6-pentamethyloxan-4-amine |
|---|---|
| PubChem CID | 143366374 |
| Molecular Formula | C10H21NO |
| Molecular Weight | 171.28 g/mol |
| Exact Mass | 171.16 |
| IUPAC Name | (3R,4S,6R)-N,N,2,3,6-pentamethyloxan-4-amine |
| SMILES | CC1O[C@H](C)C[C@H](N(C)C)[C@H]1C |
| InChI | InChI=1S/C10H21NO/c1-7-6-10(11(4)5)8(2)9(3)12-7/h7-10H,6H2,1-5H3/t7-,8+,9?,10+/m1/s1 |
| InChIKey | CKNBXFPSBAADRJ-AJDMCEKOSA-N |
| XLogP | 1.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |