C8H16INO3 — CID 134302754
[(3R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxan-3-yl] hypoiodite (PubChem CID 134302754) has the molecular formula C8H16INO3 and a molecular weight of 301.12 g/mol. Its IUPAC name is [(3R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxan-3-yl] hypoiodite.
| Compound Name | [(3R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxan-3-yl] hypoiodite |
|---|---|
| PubChem CID | 134302754 |
| Molecular Formula | C8H16INO3 |
| Molecular Weight | 301.12 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | [(3R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxan-3-yl] hypoiodite |
| SMILES | C[C@@H]1C[C@H](N(C)C)[C@@H](OI)C(O)O1 |
| InChI | InChI=1S/C8H16INO3/c1-5-4-6(10(2)3)7(13-9)8(11)12-5/h5-8,11H,4H2,1-3H3/t5-,6+,7-,8?/m1/s1 |
| InChIKey | ZWVNAMNTINZAEX-MOMMNUENSA-N |
| XLogP | 0.78 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.12 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|