C9H17NO3 — CID 142966665
(2R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxane-3-carbaldehyde (PubChem CID 142966665) has the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. Its IUPAC name is (2R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxane-3-carbaldehyde.
| Compound Name | (2R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxane-3-carbaldehyde |
|---|---|
| PubChem CID | 142966665 |
| Molecular Formula | C9H17NO3 |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.12 |
| IUPAC Name | (2R,4S,6R)-4-(dimethylamino)-2-hydroxy-6-methyloxane-3-carbaldehyde |
| SMILES | C[C@@H]1C[C@H](N(C)C)C(C=O)[C@H](O)O1 |
| InChI | InChI=1S/C9H17NO3/c1-6-4-8(10(2)3)7(5-11)9(12)13-6/h5-9,12H,4H2,1-3H3/t6-,7?,8+,9-/m1/s1 |
| InChIKey | RSNDNNSXEHOOKA-PKDUTCDESA-N |
| XLogP | -0.14 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|