C8H15NO3 — CID 144781805
N,N,3-trimethyl-2,7,8-trioxabicyclo[4.2.0]octan-5-amine (PubChem CID 144781805) has the molecular formula C8H15NO3 and a molecular weight of 173.21 g/mol. Its IUPAC name is N,N,3-trimethyl-2,7,8-trioxabicyclo[4.2.0]octan-5-amine.
| Compound Name | N,N,3-trimethyl-2,7,8-trioxabicyclo[4.2.0]octan-5-amine |
|---|---|
| PubChem CID | 144781805 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | N,N,3-trimethyl-2,7,8-trioxabicyclo[4.2.0]octan-5-amine |
| SMILES | CC1CC(N(C)C)C2OOC2O1 |
| InChI | InChI=1S/C8H15NO3/c1-5-4-6(9(2)3)7-8(10-5)12-11-7/h5-8H,4H2,1-3H3 |
| InChIKey | QNHZYSRYJPKYFW-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|