C12H25NO3 — CID 67952449
4-(dimethylamino)-6-methyl-2-[(2-methylpropan-2-yl)oxy]oxan-3-ol (PubChem CID 67952449) has the molecular formula C12H25NO3 and a molecular weight of 231.34 g/mol. Its IUPAC name is 4-(dimethylamino)-6-methyl-2-[(2-methylpropan-2-yl)oxy]oxan-3-ol.
| Compound Name | 4-(dimethylamino)-6-methyl-2-[(2-methylpropan-2-yl)oxy]oxan-3-ol |
|---|---|
| PubChem CID | 67952449 |
| Molecular Formula | C12H25NO3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.18 |
| IUPAC Name | 4-(dimethylamino)-6-methyl-2-[(2-methylpropan-2-yl)oxy]oxan-3-ol |
| SMILES | CC1CC(N(C)C)C(O)C(OC(C)(C)C)O1 |
| InChI | InChI=1S/C12H25NO3/c1-8-7-9(13(5)6)10(14)11(15-8)16-12(2,3)4/h8-11,14H,7H2,1-6H3 |
| InChIKey | MZXHJLZFVCKBCM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |