C13H23NO4 — CID 86668339
(2R,3R,4S,6R)-4-(dimethylamino)-2-(3-hydroxypent-4-ynoxy)-6-methyloxan-3-ol (PubChem CID 86668339) has the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. Its IUPAC name is (2R,3R,4S,6R)-4-(dimethylamino)-2-(3-hydroxypent-4-ynoxy)-6-methyloxan-3-ol.
| Compound Name | (2R,3R,4S,6R)-4-(dimethylamino)-2-(3-hydroxypent-4-ynoxy)-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 86668339 |
| Molecular Formula | C13H23NO4 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (2R,3R,4S,6R)-4-(dimethylamino)-2-(3-hydroxypent-4-ynoxy)-6-methyloxan-3-ol |
| SMILES | C#CC(O)CCO[C@@H]1O[C@H](C)C[C@H](N(C)C)[C@H]1O |
| InChI | InChI=1S/C13H23NO4/c1-5-10(15)6-7-17-13-12(16)11(14(3)4)8-9(2)18-13/h1,9-13,15-16H,6-8H2,2-4H3/t9-,10?,11+,12-,13-/m1/s1 |
| InChIKey | LBHYBPPMZQGIIC-GHVXPYCRSA-N |
| XLogP | -0.19 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|