C21H41NO4 — CID 67068127
(6R)-4-(dimethylamino)-2-(6-hydroxycyclotridecyl)oxy-6-methyloxan-3-ol (PubChem CID 67068127) has the molecular formula C21H41NO4 and a molecular weight of 371.56 g/mol. Its IUPAC name is (6R)-4-(dimethylamino)-2-(6-hydroxycyclotridecyl)oxy-6-methyloxan-3-ol.
| Compound Name | (6R)-4-(dimethylamino)-2-(6-hydroxycyclotridecyl)oxy-6-methyloxan-3-ol |
|---|---|
| PubChem CID | 67068127 |
| Molecular Formula | C21H41NO4 |
| Molecular Weight | 371.56 g/mol |
| Exact Mass | 371.30 |
| IUPAC Name | (6R)-4-(dimethylamino)-2-(6-hydroxycyclotridecyl)oxy-6-methyloxan-3-ol |
| SMILES | C[C@@H]1CC(N(C)C)C(O)C(OC2CCCCCCCC(O)CCCC2)O1 |
| InChI | InChI=1S/C21H41NO4/c1-16-15-19(22(2)3)20(24)21(25-16)26-18-13-8-6-4-5-7-11-17(23)12-9-10-14-18/h16-21,23-24H,4-15H2,1-3H3/t16-,17?,18?,19?,20?,21?/m1/s1 |
| InChIKey | ADQGIVUPGKPANA-HVZSQQFQSA-N |
| XLogP | 3.46 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.56 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |