C22H34N2O9 — CID 142203880
8-[(3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-2,4,5,16-tetrone (PubChem CID 142203880) has the molecular formula C22H34N2O9 and a molecular weight of 470.52 g/mol. Its IUPAC name is 8-[(3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-2,4,5,16-tetrone.
| Compound Name | 8-[(3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-2,4,5,16-tetrone |
|---|---|
| PubChem CID | 142203880 |
| Molecular Formula | C22H34N2O9 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | 8-[(3R,4S,6R)-4-(dimethylamino)-3-hydroxy-6-methyloxan-2-yl]oxy-3,17-dioxa-15-azabicyclo[12.3.0]heptadecane-2,4,5,16-tetrone |
| SMILES | C[C@@H]1C[C@H](N(C)C)[C@@H](O)C(OC2CCCCCC3NC(=O)OC3C(=O)OC(=O)C(=O)CC2)O1 |
| InChI | InChI=1S/C22H34N2O9/c1-12-11-15(24(2)3)17(26)21(30-12)31-13-7-5-4-6-8-14-18(32-22(29)23-14)20(28)33-19(27)16(25)10-9-13/h12-15,17-18,21,26H,4-11H2,1-3H3,(H,23,29)/t12-,13?,14?,15+,17-,18?,21?/m1/s1 |
| InChIKey | ZDDUQYQHMBVLGL-MBFJLIFGSA-N |
| XLogP | 0.66 |
| TPSA | 140.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|