C10H18INO4 — CID 145284278
[(3R)-4-(dimethylamino)-2-iodooxy-6-methyloxan-3-yl] acetate (PubChem CID 145284278) has the molecular formula C10H18INO4 and a molecular weight of 343.16 g/mol. Its IUPAC name is [(3R)-4-(dimethylamino)-2-iodooxy-6-methyloxan-3-yl] acetate.
| Compound Name | [(3R)-4-(dimethylamino)-2-iodooxy-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 145284278 |
| Molecular Formula | C10H18INO4 |
| Molecular Weight | 343.16 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | [(3R)-4-(dimethylamino)-2-iodooxy-6-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@H]1C(OI)OC(C)CC1N(C)C |
| InChI | InChI=1S/C10H18INO4/c1-6-5-8(12(3)4)9(15-7(2)13)10(14-6)16-11/h6,8-10H,5H2,1-4H3/t6?,8?,9-,10?/m1/s1 |
| InChIKey | REKNLCFEHQIDLD-HTIATLJVSA-N |
| XLogP | 1.35 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.16 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|