C25H37N5O6 — CID 174206576
[4-(dimethylamino)-2-[4-[1-[7-(hydroxyamino)-7-oxoheptyl]triazol-4-yl]phenoxy]-6-methyloxan-3-yl] acetate (PubChem CID 174206576) has the molecular formula C25H37N5O6 and a molecular weight of 503.60 g/mol. Its IUPAC name is [4-(dimethylamino)-2-[4-[1-[7-(hydroxyamino)-7-oxoheptyl]triazol-4-yl]phenoxy]-6-methyloxan-3-yl] acetate.
| Compound Name | [4-(dimethylamino)-2-[4-[1-[7-(hydroxyamino)-7-oxoheptyl]triazol-4-yl]phenoxy]-6-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 174206576 |
| Molecular Formula | C25H37N5O6 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.27 |
| IUPAC Name | [4-(dimethylamino)-2-[4-[1-[7-(hydroxyamino)-7-oxoheptyl]triazol-4-yl]phenoxy]-6-methyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1C(Oc2ccc(-c3cn(CCCCCCC(=O)NO)nn3)cc2)OC(C)CC1N(C)C |
| InChI | InChI=1S/C25H37N5O6/c1-17-15-22(29(3)4)24(35-18(2)31)25(34-17)36-20-12-10-19(11-13-20)21-16-30(28-26-21)14-8-6-5-7-9-23(32)27-33/h10-13,16-17,22,24-25,33H,5-9,14-15H2,1-4H3,(H,27,32) |
| InChIKey | AHWZDOZLVSUVMA-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 128.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|