C32H39ClN6O4 — CID 177295489
N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[1-[8-(hydroxyamino)-8-oxooctyl]triazol-4-yl]benzamide (PubChem CID 177295489) has the molecular formula C32H39ClN6O4 and a molecular weight of 607.15 g/mol. Its IUPAC name is N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[1-[8-(hydroxyamino)-8-oxooctyl]triazol-4-yl]benzamide.
| Compound Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[1-[8-(hydroxyamino)-8-oxooctyl]triazol-4-yl]benzamide |
|---|---|
| PubChem CID | 177295489 |
| Molecular Formula | C32H39ClN6O4 |
| Molecular Weight | 607.15 g/mol |
| Exact Mass | 606.27 |
| IUPAC Name | N-[3-(3-chloro-4-cyanophenoxy)-2,2,4,4-tetramethylcyclobutyl]-4-[1-[8-(hydroxyamino)-8-oxooctyl]triazol-4-yl]benzamide |
| SMILES | CC1(C)C(NC(=O)c2ccc(-c3cn(CCCCCCCC(=O)NO)nn3)cc2)C(C)(C)C1Oc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C32H39ClN6O4/c1-31(2)29(32(3,4)30(31)43-24-16-15-23(19-34)25(33)18-24)35-28(41)22-13-11-21(12-14-22)26-20-39(38-36-26)17-9-7-5-6-8-10-27(40)37-42/h11-16,18,20,29-30,42H,5-10,17H2,1-4H3,(H,35,41)(H,37,40) |
| InChIKey | RZGZCIRIJMKEJM-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 142.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.15 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|