C21H26N4O6 — CID 155214476
[5-acetamido-4-acetyloxy-6-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxan-3-yl] acetate (PubChem CID 155214476) has the molecular formula C21H26N4O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is [5-acetamido-4-acetyloxy-6-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxan-3-yl] acetate.
| Compound Name | [5-acetamido-4-acetyloxy-6-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 155214476 |
| Molecular Formula | C21H26N4O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [5-acetamido-4-acetyloxy-6-methyl-2-[(4-phenyltriazol-1-yl)methyl]oxan-3-yl] acetate |
| SMILES | CC(=O)NC1C(C)OC(Cn2cc(-c3ccccc3)nn2)C(OC(C)=O)C1OC(C)=O |
| InChI | InChI=1S/C21H26N4O6/c1-12-19(22-13(2)26)21(31-15(4)28)20(30-14(3)27)18(29-12)11-25-10-17(23-24-25)16-8-6-5-7-9-16/h5-10,12,18-21H,11H2,1-4H3,(H,22,26) |
| InChIKey | ZQKIICNRWBPNFG-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 121.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |