C25H28N6O8 — CID 102487964
[(2R,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[4-(azidomethyl)triazol-1-yl]methyl]-2-[(E)-2-oxo-4-phenylbut-3-enyl]oxan-3-yl] acetate (PubChem CID 102487964) has the molecular formula C25H28N6O8 and a molecular weight of 540.53 g/mol. Its IUPAC name is [(2R,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[4-(azidomethyl)triazol-1-yl]methyl]-2-[(E)-2-oxo-4-phenylbut-3-enyl]oxan-3-yl] acetate.
| Compound Name | [(2R,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[4-(azidomethyl)triazol-1-yl]methyl]-2-[(E)-2-oxo-4-phenylbut-3-enyl]oxan-3-yl] acetate |
|---|---|
| PubChem CID | 102487964 |
| Molecular Formula | C25H28N6O8 |
| Molecular Weight | 540.53 g/mol |
| Exact Mass | 540.20 |
| IUPAC Name | [(2R,3S,4R,5R,6R)-4,5-diacetyloxy-6-[[4-(azidomethyl)triazol-1-yl]methyl]-2-[(E)-2-oxo-4-phenylbut-3-enyl]oxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@@H](CC(=O)/C=C/c2ccccc2)O[C@H](Cn2cc(CN=[N+]=[N-])nn2)[C@H]1OC(C)=O |
| InChI | InChI=1S/C25H28N6O8/c1-15(32)36-23-21(11-20(35)10-9-18-7-5-4-6-8-18)39-22(14-31-13-19(28-30-31)12-27-29-26)24(37-16(2)33)25(23)38-17(3)34/h4-10,13,21-25H,11-12,14H2,1-3H3/b10-9+/t21-,22-,23+,24-,25-/m1/s1 |
| InChIKey | RTOUDJPACXPWPS-SYWSGIIBSA-N |
| XLogP | 2.32 |
| TPSA | 184.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|