C33H44N4O7 — CID 158382427
benzyl 8-[3-acetamido-4-hydroxy-6-[[4-(3-methoxyphenyl)triazol-1-yl]methyl]-5-methyloxan-2-yl]oxyoctanoate (PubChem CID 158382427) has the molecular formula C33H44N4O7 and a molecular weight of 608.74 g/mol. Its IUPAC name is benzyl 8-[3-acetamido-4-hydroxy-6-[[4-(3-methoxyphenyl)triazol-1-yl]methyl]-5-methyloxan-2-yl]oxyoctanoate.
| Compound Name | benzyl 8-[3-acetamido-4-hydroxy-6-[[4-(3-methoxyphenyl)triazol-1-yl]methyl]-5-methyloxan-2-yl]oxyoctanoate |
|---|---|
| PubChem CID | 158382427 |
| Molecular Formula | C33H44N4O7 |
| Molecular Weight | 608.74 g/mol |
| Exact Mass | 608.32 |
| IUPAC Name | benzyl 8-[3-acetamido-4-hydroxy-6-[[4-(3-methoxyphenyl)triazol-1-yl]methyl]-5-methyloxan-2-yl]oxyoctanoate |
| SMILES | COc1cccc(-c2cn(CC3OC(OCCCCCCCC(=O)OCc4ccccc4)C(NC(C)=O)C(O)C3C)nn2)c1 |
| InChI | InChI=1S/C33H44N4O7/c1-23-29(21-37-20-28(35-36-37)26-15-12-16-27(19-26)41-3)44-33(31(32(23)40)34-24(2)38)42-18-11-6-4-5-10-17-30(39)43-22-25-13-8-7-9-14-25/h7-9,12-16,19-20,23,29,31-33,40H,4-6,10-11,17-18,21-22H2,1-3H3,(H,34,38) |
| InChIKey | UZKZOZSKWYCYHZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 134.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|