C24H39N3O7 — CID 129151947
N-[[5-acetamido-6-(6-aminohexoxy)-3,4-dihydroxyoxan-2-yl]methyl]-3-(3-methoxyphenyl)propanamide (PubChem CID 129151947) has the molecular formula C24H39N3O7 and a molecular weight of 481.59 g/mol. Its IUPAC name is N-[[5-acetamido-6-(6-aminohexoxy)-3,4-dihydroxyoxan-2-yl]methyl]-3-(3-methoxyphenyl)propanamide.
| Compound Name | N-[[5-acetamido-6-(6-aminohexoxy)-3,4-dihydroxyoxan-2-yl]methyl]-3-(3-methoxyphenyl)propanamide |
|---|---|
| PubChem CID | 129151947 |
| Molecular Formula | C24H39N3O7 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.28 |
| IUPAC Name | N-[[5-acetamido-6-(6-aminohexoxy)-3,4-dihydroxyoxan-2-yl]methyl]-3-(3-methoxyphenyl)propanamide |
| SMILES | COc1cccc(CCC(=O)NCC2OC(OCCCCCCN)C(NC(C)=O)C(O)C2O)c1 |
| InChI | InChI=1S/C24H39N3O7/c1-16(28)27-21-23(31)22(30)19(34-24(21)33-13-6-4-3-5-12-25)15-26-20(29)11-10-17-8-7-9-18(14-17)32-2/h7-9,14,19,21-24,30-31H,3-6,10-13,15,25H2,1-2H3,(H,26,29)(H,27,28) |
| InChIKey | RPPDRKVLXWJPNL-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 152.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|