C36H59N5O10 — CID 146619631
N'-[[5-acetamido-6-[8-(carbamoylamino)-8-oxooctoxy]-3,4-dihydroxyoxan-2-yl]methyl]-N-[2-(3-methoxyphenyl)ethyl]decanediamide (PubChem CID 146619631) has the molecular formula C36H59N5O10 and a molecular weight of 721.89 g/mol. Its IUPAC name is N'-[[5-acetamido-6-[8-(carbamoylamino)-8-oxooctoxy]-3,4-dihydroxyoxan-2-yl]methyl]-N-[2-(3-methoxyphenyl)ethyl]decanediamide.
| Compound Name | N'-[[5-acetamido-6-[8-(carbamoylamino)-8-oxooctoxy]-3,4-dihydroxyoxan-2-yl]methyl]-N-[2-(3-methoxyphenyl)ethyl]decanediamide |
|---|---|
| PubChem CID | 146619631 |
| Molecular Formula | C36H59N5O10 |
| Molecular Weight | 721.89 g/mol |
| Exact Mass | 721.43 |
| IUPAC Name | N'-[[5-acetamido-6-[8-(carbamoylamino)-8-oxooctoxy]-3,4-dihydroxyoxan-2-yl]methyl]-N-[2-(3-methoxyphenyl)ethyl]decanediamide |
| SMILES | COc1cccc(CCNC(=O)CCCCCCCCC(=O)NCC2OC(OCCCCCCCC(=O)NC(N)=O)C(NC(C)=O)C(O)C2O)c1 |
| InChI | InChI=1S/C36H59N5O10/c1-25(42)40-32-34(47)33(46)28(51-35(32)50-22-13-9-5-8-12-19-31(45)41-36(37)48)24-39-30(44)18-11-7-4-3-6-10-17-29(43)38-21-20-26-15-14-16-27(23-26)49-2/h14-16,23,28,32-35,46-47H,3-13,17-22,24H2,1-2H3,(H,38,43)(H,39,44)(H,40,42)(H3,37,41,45,48) |
| InChIKey | CLOAOLWGSHMHDC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 227.64 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 721.89 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|