C36H60N4O10 — CID 123289812
N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(3-methoxypropyl)-2,2,4,4-tetramethylpentanediamide (PubChem CID 123289812) has the molecular formula C36H60N4O10 and a molecular weight of 708.89 g/mol. Its IUPAC name is N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(3-methoxypropyl)-2,2,4,4-tetramethylpentanediamide.
| Compound Name | N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(3-methoxypropyl)-2,2,4,4-tetramethylpentanediamide |
|---|---|
| PubChem CID | 123289812 |
| Molecular Formula | C36H60N4O10 |
| Molecular Weight | 708.89 g/mol |
| Exact Mass | 708.43 |
| IUPAC Name | N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(3-methoxypropyl)-2,2,4,4-tetramethylpentanediamide |
| SMILES | COCCCNC(=O)C(C)(C)CC(C)(C)C(=O)NCCCCCCOC1OC(CNC(=O)Cc2cccc(OC)c2)C(O)C(O)C1NC(C)=O |
| InChI | InChI=1S/C36H60N4O10/c1-24(41)40-29-31(44)30(43)27(22-39-28(42)21-25-14-12-15-26(20-25)48-7)50-32(29)49-19-11-9-8-10-16-37-33(45)35(2,3)23-36(4,5)34(46)38-17-13-18-47-6/h12,14-15,20,27,29-32,43-44H,8-11,13,16-19,21-23H2,1-7H3,(H,37,45)(H,38,46)(H,39,42)(H,40,41) |
| InChIKey | YMFWWKWAKVUDSF-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 193.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.89 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|