C26H50FN4O9+ — CID 123857134
[[5-[6-[3-[(2-fluoroacetyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylamino]-2,2,4,4-tetramethyl-5-oxopentanoyl]amino]-methoxy-dimethylazanium (PubChem CID 123857134) has the molecular formula C26H50FN4O9+ and a molecular weight of 581.70 g/mol. Its IUPAC name is [[5-[6-[3-[(2-fluoroacetyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylamino]-2,2,4,4-tetramethyl-5-oxopentanoyl]amino]-methoxy-dimethylazanium.
| Compound Name | [[5-[6-[3-[(2-fluoroacetyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylamino]-2,2,4,4-tetramethyl-5-oxopentanoyl]amino]-methoxy-dimethylazanium |
|---|---|
| PubChem CID | 123857134 |
| Molecular Formula | C26H50FN4O9+ |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 581.36 |
| IUPAC Name | [[5-[6-[3-[(2-fluoroacetyl)amino]-4,5-dihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexylamino]-2,2,4,4-tetramethyl-5-oxopentanoyl]amino]-methoxy-dimethylazanium |
| SMILES | CO[N+](C)(C)NC(=O)C(C)(C)CC(C)(C)C(=O)NCCCCCCOC1OC(CO)C(O)C(O)C1NC(=O)CF |
| InChI | InChI=1S/C26H49FN4O9/c1-25(2,16-26(3,4)24(37)30-31(5,6)38-7)23(36)28-12-10-8-9-11-13-39-22-19(29-18(33)14-27)21(35)20(34)17(15-32)40-22/h17,19-22,32,34-35H,8-16H2,1-7H3,(H2-,28,29,30,33,36,37)/p+1 |
| InChIKey | PXMGSDZYKBUBSY-UHFFFAOYSA-O |
| XLogP | -0.32 |
| TPSA | 175.68 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|