C30H48N4O10 — CID 129148777
N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(propan-2-yloxymethyl)propanediamide (PubChem CID 129148777) has the molecular formula C30H48N4O10 and a molecular weight of 624.73 g/mol. Its IUPAC name is N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(propan-2-yloxymethyl)propanediamide.
| Compound Name | N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(propan-2-yloxymethyl)propanediamide |
|---|---|
| PubChem CID | 129148777 |
| Molecular Formula | C30H48N4O10 |
| Molecular Weight | 624.73 g/mol |
| Exact Mass | 624.34 |
| IUPAC Name | N-[6-[3-acetamido-4,5-dihydroxy-6-[[[2-(3-methoxyphenyl)acetyl]amino]methyl]oxan-2-yl]oxyhexyl]-N'-(propan-2-yloxymethyl)propanediamide |
| SMILES | COc1cccc(CC(=O)NCC2OC(OCCCCCCNC(=O)CC(=O)NCOC(C)C)C(NC(C)=O)C(O)C2O)c1 |
| InChI | InChI=1S/C30H48N4O10/c1-19(2)43-18-33-26(38)16-25(37)31-12-7-5-6-8-13-42-30-27(34-20(3)35)29(40)28(39)23(44-30)17-32-24(36)15-21-10-9-11-22(14-21)41-4/h9-11,14,19,23,27-30,39-40H,5-8,12-13,15-18H2,1-4H3,(H,31,37)(H,32,36)(H,33,38)(H,34,35) |
| InChIKey | VFOFGSZJUPTEAQ-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 193.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.73 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|