C20H28N4O4 — CID 164565007
6-[4-[4-[(2R)-3-hydroxy-6-methyloxan-2-yl]oxyphenyl]triazol-1-yl]hexanamide (PubChem CID 164565007) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 6-[4-[4-[(2R)-3-hydroxy-6-methyloxan-2-yl]oxyphenyl]triazol-1-yl]hexanamide.
| Compound Name | 6-[4-[4-[(2R)-3-hydroxy-6-methyloxan-2-yl]oxyphenyl]triazol-1-yl]hexanamide |
|---|---|
| PubChem CID | 164565007 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 6-[4-[4-[(2R)-3-hydroxy-6-methyloxan-2-yl]oxyphenyl]triazol-1-yl]hexanamide |
| SMILES | CC1CCC(O)[C@@H](Oc2ccc(-c3cn(CCCCCC(N)=O)nn3)cc2)O1 |
| InChI | InChI=1S/C20H28N4O4/c1-14-6-11-18(25)20(27-14)28-16-9-7-15(8-10-16)17-13-24(23-22-17)12-4-2-3-5-19(21)26/h7-10,13-14,18,20,25H,2-6,11-12H2,1H3,(H2,21,26)/t14?,18?,20-/m1/s1 |
| InChIKey | OHPHEWDFJVFULT-FPMRRHDISA-N |
| XLogP | 2.26 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|