C21H30N4O4 — CID 166325865
5-[4-[4-[2-(2-methylpentan-3-ylamino)-2-oxoethoxy]phenyl]triazol-1-yl]pentanoic acid (PubChem CID 166325865) has the molecular formula C21H30N4O4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 5-[4-[4-[2-(2-methylpentan-3-ylamino)-2-oxoethoxy]phenyl]triazol-1-yl]pentanoic acid.
| Compound Name | 5-[4-[4-[2-(2-methylpentan-3-ylamino)-2-oxoethoxy]phenyl]triazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 166325865 |
| Molecular Formula | C21H30N4O4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 5-[4-[4-[2-(2-methylpentan-3-ylamino)-2-oxoethoxy]phenyl]triazol-1-yl]pentanoic acid |
| SMILES | CCC(NC(=O)COc1ccc(-c2cn(CCCCC(=O)O)nn2)cc1)C(C)C |
| InChI | InChI=1S/C21H30N4O4/c1-4-18(15(2)3)22-20(26)14-29-17-10-8-16(9-11-17)19-13-25(24-23-19)12-6-5-7-21(27)28/h8-11,13,15,18H,4-7,12,14H2,1-3H3,(H,22,26)(H,27,28) |
| InChIKey | GWWMTLVWXRNPSC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 106.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|