C16H23N5O3 — CID 123132730
N-(1-hydroxy-3-methylpentan-2-yl)-2-[4-(2-methyltetrazol-5-yl)phenoxy]acetamide (PubChem CID 123132730) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(1-hydroxy-3-methylpentan-2-yl)-2-[4-(2-methyltetrazol-5-yl)phenoxy]acetamide.
| Compound Name | N-(1-hydroxy-3-methylpentan-2-yl)-2-[4-(2-methyltetrazol-5-yl)phenoxy]acetamide |
|---|---|
| PubChem CID | 123132730 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | N-(1-hydroxy-3-methylpentan-2-yl)-2-[4-(2-methyltetrazol-5-yl)phenoxy]acetamide |
| SMILES | CCC(C)C(CO)NC(=O)COc1ccc(-c2nnn(C)n2)cc1 |
| InChI | InChI=1S/C16H23N5O3/c1-4-11(2)14(9-22)17-15(23)10-24-13-7-5-12(6-8-13)16-18-20-21(3)19-16/h5-8,11,14,22H,4,9-10H2,1-3H3,(H,17,23) |
| InChIKey | BEJNUVXZEWZUHK-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 102.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |