C13H18ClNO3 — CID 74554708
2-(4-chlorophenoxy)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide (PubChem CID 74554708) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide.
| Compound Name | 2-(4-chlorophenoxy)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 74554708 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-(1-hydroxy-3-methylbutan-2-yl)acetamide |
| SMILES | CC(C)C(CO)NC(=O)COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H18ClNO3/c1-9(2)12(7-16)15-13(17)8-18-11-5-3-10(14)4-6-11/h3-6,9,12,16H,7-8H2,1-2H3,(H,15,17) |
| InChIKey | CFSOFGYPTVYFPZ-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |