C18H19ClFNO3 — CID 146087967
2-(3-chloro-4-fluorophenoxy)-N-(1-hydroxy-3-phenylbutan-2-yl)acetamide (PubChem CID 146087967) has the molecular formula C18H19ClFNO3 and a molecular weight of 351.81 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenoxy)-N-(1-hydroxy-3-phenylbutan-2-yl)acetamide.
| Compound Name | 2-(3-chloro-4-fluorophenoxy)-N-(1-hydroxy-3-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 146087967 |
| Molecular Formula | C18H19ClFNO3 |
| Molecular Weight | 351.81 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 2-(3-chloro-4-fluorophenoxy)-N-(1-hydroxy-3-phenylbutan-2-yl)acetamide |
| SMILES | CC(c1ccccc1)C(CO)NC(=O)COc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C18H19ClFNO3/c1-12(13-5-3-2-4-6-13)17(10-22)21-18(23)11-24-14-7-8-16(20)15(19)9-14/h2-9,12,17,22H,10-11H2,1H3,(H,21,23) |
| InChIKey | PCMYUNQAAJOPCI-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.81 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |