C12H19O10P — CID 57038168
[(2S,3R,4R,5S)-4,5-diacetyloxy-6-dihydroxyphosphanyloxy-2-methyloxan-3-yl] acetate (PubChem CID 57038168) has the molecular formula C12H19O10P and a molecular weight of 354.25 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4,5-diacetyloxy-6-dihydroxyphosphanyloxy-2-methyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S)-4,5-diacetyloxy-6-dihydroxyphosphanyloxy-2-methyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 57038168 |
| Molecular Formula | C12H19O10P |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | [(2S,3R,4R,5S)-4,5-diacetyloxy-6-dihydroxyphosphanyloxy-2-methyloxan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H](OC(C)=O)[C@H](C)OC(OP(O)O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C12H19O10P/c1-5-9(19-6(2)13)10(20-7(3)14)11(21-8(4)15)12(18-5)22-23(16)17/h5,9-12,16-17H,1-4H3/t5-,9+,10+,11-,12?/m0/s1 |
| InChIKey | OZOQRDHWXUMKBB-PFFKSSDRSA-N |
| XLogP | -0.25 |
| TPSA | 137.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|