C7H14O6 — CID 102127943
(2R,3S,4S,5R,6R)-3-deuterio-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol (PubChem CID 102127943) has the molecular formula C7H14O6 and a molecular weight of 195.19 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-3-deuterio-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-3-deuterio-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 102127943 |
| Molecular Formula | C7H14O6 |
| Molecular Weight | 195.19 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | (2R,3S,4S,5R,6R)-3-deuterio-2-(hydroxymethyl)-6-methoxyoxane-3,4,5-triol |
| SMILES | [2H][C@]1(O)[C@H](O)[C@@H](O)[C@H](OC)O[C@@H]1CO |
| InChI | InChI=1S/C7H14O6/c1-12-7-6(11)5(10)4(9)3(2-8)13-7/h3-11H,2H2,1H3/t3-,4-,5+,6-,7-/m1/s1/i4D |
| InChIKey | HOVAGTYPODGVJG-VLSKUYEGSA-N |
| XLogP | -2.57 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.19 |
| LogP ≤ 5 | -2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |