About 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid
2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid (PubChem CID 135375239) has the molecular formula C13H19N3O8
and a molecular weight of 345.31 g/mol. Its IUPAC name is 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid |
| PubChem CID | 135375239 |
| Molecular Formula | C13H19N3O8 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid |
| SMILES | COC1OC(CN=[N+]=[N-])C(CC(=O)O)C(CC(=O)O)C1CC(=O)O |
| InChI | InChI=1S/C13H19N3O8/c1-23-13-8(4-12(21)22)6(2-10(17)18)7(3-11(19)20)9(24-13)5-15-16-14/h6-9,13H,2-5H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | KEHSRCCMTJODJA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 179.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid?
The IUPAC name of 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid (CID 135375239) is 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid.
What is the SMILES notation for 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid?
The canonical SMILES for 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid is COC1OC(CN=[N+]=[N-])C(CC(=O)O)C(CC(=O)O)C1CC(=O)O.
What is the InChIKey of 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid?
The InChIKey is KEHSRCCMTJODJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O8/c1-23-13-8(4-12(21)22)6(2-10(17)18)7(3-11(19)20)9(24-13)5-15-16-14/h6-9,13H,2-5H2,1H3,(H,17,18)(H,19,20)(H,21,22).
What are the key properties of 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid?
2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid has a molecular weight of 345.31 g/mol, XLogP of 0.94, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid is sourced from PubChem (CID 135375239), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).