C13H19N3O8 — CID 135375239
2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid (PubChem CID 135375239) has the molecular formula C13H19N3O8 and a molecular weight of 345.31 g/mol. Its IUPAC name is 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid.
| Compound Name | 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 135375239 |
| Molecular Formula | C13H19N3O8 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 2-[2-(azidomethyl)-3,5-bis(carboxymethyl)-6-methoxyoxan-4-yl]acetic acid |
| SMILES | COC1OC(CN=[N+]=[N-])C(CC(=O)O)C(CC(=O)O)C1CC(=O)O |
| InChI | InChI=1S/C13H19N3O8/c1-23-13-8(4-12(21)22)6(2-10(17)18)7(3-11(19)20)9(24-13)5-15-16-14/h6-9,13H,2-5H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | KEHSRCCMTJODJA-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 179.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|