C13H17N3O9 — CID 129048071
2-[2-azido-3,5-bis(carboxymethyl)-6-methoxycarbonyloxan-4-yl]acetic acid (PubChem CID 129048071) has the molecular formula C13H17N3O9 and a molecular weight of 359.29 g/mol. Its IUPAC name is 2-[2-azido-3,5-bis(carboxymethyl)-6-methoxycarbonyloxan-4-yl]acetic acid.
| Compound Name | 2-[2-azido-3,5-bis(carboxymethyl)-6-methoxycarbonyloxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 129048071 |
| Molecular Formula | C13H17N3O9 |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | 2-[2-azido-3,5-bis(carboxymethyl)-6-methoxycarbonyloxan-4-yl]acetic acid |
| SMILES | COC(=O)C1OC(N=[N+]=[N-])C(CC(=O)O)C(CC(=O)O)C1CC(=O)O |
| InChI | InChI=1S/C13H17N3O9/c1-24-13(23)11-6(3-9(19)20)5(2-8(17)18)7(4-10(21)22)12(25-11)15-16-14/h5-7,11-12H,2-4H2,1H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | UXCNVABIGQQDCR-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 196.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|