C16H24O11 — CID 175061559
2-[(2R,3R,5S,6S)-3,5-bis(carboxymethyl)-2-(3-hydroxypropoxy)-6-methoxycarbonyloxan-4-yl]acetic acid (PubChem CID 175061559) has the molecular formula C16H24O11 and a molecular weight of 392.36 g/mol. Its IUPAC name is 2-[(2R,3R,5S,6S)-3,5-bis(carboxymethyl)-2-(3-hydroxypropoxy)-6-methoxycarbonyloxan-4-yl]acetic acid.
| Compound Name | 2-[(2R,3R,5S,6S)-3,5-bis(carboxymethyl)-2-(3-hydroxypropoxy)-6-methoxycarbonyloxan-4-yl]acetic acid |
|---|---|
| PubChem CID | 175061559 |
| Molecular Formula | C16H24O11 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 2-[(2R,3R,5S,6S)-3,5-bis(carboxymethyl)-2-(3-hydroxypropoxy)-6-methoxycarbonyloxan-4-yl]acetic acid |
| SMILES | COC(=O)[C@H]1O[C@@H](OCCCO)[C@H](CC(=O)O)C(CC(=O)O)[C@@H]1CC(=O)O |
| InChI | InChI=1S/C16H24O11/c1-25-15(24)14-9(6-12(20)21)8(5-11(18)19)10(7-13(22)23)16(27-14)26-4-2-3-17/h8-10,14,16-17H,2-7H2,1H3,(H,18,19)(H,20,21)(H,22,23)/t8?,9-,10+,14-,16+/m0/s1 |
| InChIKey | SVKIIRHQYWMWQD-NNJOONMDSA-N |
| XLogP | -0.44 |
| TPSA | 176.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|