C11H20IO4PV — CID 59036525
methyl (2R,3R,4S,5R,6S)-6-(iodophosphanyloxymethyl)-3,4,5-trimethyloxane-2-carboxylate;vanadium (PubChem CID 59036525) has the molecular formula C11H20IO4PV and a molecular weight of 425.10 g/mol. Its IUPAC name is methyl (2R,3R,4S,5R,6S)-6-(iodophosphanyloxymethyl)-3,4,5-trimethyloxane-2-carboxylate;vanadium.
| Compound Name | methyl (2R,3R,4S,5R,6S)-6-(iodophosphanyloxymethyl)-3,4,5-trimethyloxane-2-carboxylate;vanadium |
|---|---|
| PubChem CID | 59036525 |
| Molecular Formula | C11H20IO4PV |
| Molecular Weight | 425.10 g/mol |
| Exact Mass | 424.96 |
| IUPAC Name | methyl (2R,3R,4S,5R,6S)-6-(iodophosphanyloxymethyl)-3,4,5-trimethyloxane-2-carboxylate;vanadium |
| SMILES | COC(=O)[C@@H]1O[C@H](COPI)[C@H](C)[C@H](C)[C@H]1C.[V] |
| InChI | InChI=1S/C11H20IO4P.V/c1-6-7(2)9(5-15-17-12)16-10(8(6)3)11(13)14-4;/h6-10,17H,5H2,1-4H3;/t6-,7+,8+,9+,10+;/m0./s1 |
| InChIKey | WLAUBZHOJPUWMT-MSIKLVLDSA-N |
| XLogP | 2.79 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.10 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|