C11H17BrO5 — CID 167624729
methyl (2S,3S,4S,5R)-5-acetyloxy-6-bromo-3,4-dimethyloxane-2-carboxylate (PubChem CID 167624729) has the molecular formula C11H17BrO5 and a molecular weight of 309.16 g/mol. Its IUPAC name is methyl (2S,3S,4S,5R)-5-acetyloxy-6-bromo-3,4-dimethyloxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S,5R)-5-acetyloxy-6-bromo-3,4-dimethyloxane-2-carboxylate |
|---|---|
| PubChem CID | 167624729 |
| Molecular Formula | C11H17BrO5 |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | methyl (2S,3S,4S,5R)-5-acetyloxy-6-bromo-3,4-dimethyloxane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(Br)[C@H](OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C11H17BrO5/c1-5-6(2)9(11(14)15-4)17-10(12)8(5)16-7(3)13/h5-6,8-10H,1-4H3/t5-,6-,8+,9-,10?/m0/s1 |
| InChIKey | AJLCRETVKWAXIG-DKURUWEKSA-N |
| XLogP | 1.48 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|