C6H11NO2 — CID 105427429
2-(aminomethyl)-3-methylcyclopropane-1-carboxylic acid (PubChem CID 105427429) has the molecular formula C6H11NO2 and a molecular weight of 129.16 g/mol. Its IUPAC name is 2-(aminomethyl)-3-methylcyclopropane-1-carboxylic acid.
| Compound Name | 2-(aminomethyl)-3-methylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 105427429 |
| Molecular Formula | C6H11NO2 |
| Molecular Weight | 129.16 g/mol |
| Exact Mass | 129.08 |
| IUPAC Name | 2-(aminomethyl)-3-methylcyclopropane-1-carboxylic acid |
| SMILES | CC1C(CN)C1C(=O)O |
| InChI | InChI=1S/C6H11NO2/c1-3-4(2-7)5(3)6(8)9/h3-5H,2,7H2,1H3,(H,8,9) |
| InChIKey | SGSSFWSBJQYDBL-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.16 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |