5-methylcyclopentane-1,2,3,4-tetracarboxylic acid

C10H12O8 — CID 20514196

IUPAC5-methylcyclopentane-1,2,3,4-tetracarboxylic acid
SMILESCC1C(C(=O)O)C(C(=O)O)C(C(=O)O)C1C(=O)O
InChIInChI=1S/C10H12O8/c1-2-3(7(11)12)5(9(15)16)6(10(17)18)4(2)8(13)14/h2-6H,1H3,(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChIKeyOZQRWHIABDGGGU-UHFFFAOYSA-N
MW260.20 g/mol
LogP-0.56
Rot. Bonds4

About 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid

5-methylcyclopentane-1,2,3,4-tetracarboxylic acid (PubChem CID 20514196) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid.

Molecular Properties

Compound Name5-methylcyclopentane-1,2,3,4-tetracarboxylic acid
PubChem CID20514196
Molecular FormulaC10H12O8
Molecular Weight260.20 g/mol
Exact Mass260.05
IUPAC Name5-methylcyclopentane-1,2,3,4-tetracarboxylic acid
SMILESCC1C(C(=O)O)C(C(=O)O)C(C(=O)O)C1C(=O)O
InChIInChI=1S/C10H12O8/c1-2-3(7(11)12)5(9(15)16)6(10(17)18)4(2)8(13)14/h2-6H,1H3,(H,11,12)(H,13,14)(H,15,16)(H,17,18)
InChIKeyOZQRWHIABDGGGU-UHFFFAOYSA-N
XLogP-0.56
TPSA149.20 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.20
LogP ≤ 5-0.56
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid?
The IUPAC name of 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid (CID 20514196) is 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid.
What is the SMILES notation for 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid?
The canonical SMILES for 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid is CC1C(C(=O)O)C(C(=O)O)C(C(=O)O)C1C(=O)O.
What is the InChIKey of 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid?
The InChIKey is OZQRWHIABDGGGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O8/c1-2-3(7(11)12)5(9(15)16)6(10(17)18)4(2)8(13)14/h2-6H,1H3,(H,11,12)(H,13,14)(H,15,16)(H,17,18).
What are the key properties of 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid?
5-methylcyclopentane-1,2,3,4-tetracarboxylic acid has a molecular weight of 260.20 g/mol, XLogP of -0.56, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid is sourced from PubChem (CID 20514196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).