C10H12O8 — CID 20514196
5-methylcyclopentane-1,2,3,4-tetracarboxylic acid (PubChem CID 20514196) has the molecular formula C10H12O8 and a molecular weight of 260.20 g/mol. Its IUPAC name is 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid.
| Compound Name | 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid |
|---|---|
| PubChem CID | 20514196 |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 5-methylcyclopentane-1,2,3,4-tetracarboxylic acid |
| SMILES | CC1C(C(=O)O)C(C(=O)O)C(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C10H12O8/c1-2-3(7(11)12)5(9(15)16)6(10(17)18)4(2)8(13)14/h2-6H,1H3,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | OZQRWHIABDGGGU-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.20 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |