C6H14N2O3 — CID 163802342
6-propan-2-yl-1,3,5-trioxane-2,4-diamine (PubChem CID 163802342) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 6-propan-2-yl-1,3,5-trioxane-2,4-diamine.
| Compound Name | 6-propan-2-yl-1,3,5-trioxane-2,4-diamine |
|---|---|
| PubChem CID | 163802342 |
| Molecular Formula | C6H14N2O3 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 6-propan-2-yl-1,3,5-trioxane-2,4-diamine |
| SMILES | CC(C)C1OC(N)OC(N)O1 |
| InChI | InChI=1S/C6H14N2O3/c1-3(2)4-9-5(7)11-6(8)10-4/h3-6H,7-8H2,1-2H3 |
| InChIKey | HLFVXYKKYBLZSR-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |