C12H26 — CID 173494930
2,3,4,6,6-pentamethyl-2-tritioheptane (PubChem CID 173494930) has the molecular formula C12H26 and a molecular weight of 172.35 g/mol. Its IUPAC name is 2,3,4,6,6-pentamethyl-2-tritioheptane.
| Compound Name | 2,3,4,6,6-pentamethyl-2-tritioheptane |
|---|---|
| PubChem CID | 173494930 |
| Molecular Formula | C12H26 |
| Molecular Weight | 172.35 g/mol |
| Exact Mass | 172.21 |
| IUPAC Name | 2,3,4,6,6-pentamethyl-2-tritioheptane |
| SMILES | [3H]C(C)(C)C(C)C(C)CC(C)(C)C |
| InChI | InChI=1S/C12H26/c1-9(2)11(4)10(3)8-12(5,6)7/h9-11H,8H2,1-7H3/i9T |
| InChIKey | JVESFBBBMJIZLO-FIRFLZKJSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.35 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |