C8H17F2N — CID 134163261
4,4-difluoro-N-methyl-2-propan-2-ylbutan-1-amine (PubChem CID 134163261) has the molecular formula C8H17F2N and a molecular weight of 165.23 g/mol. Its IUPAC name is 4,4-difluoro-N-methyl-2-propan-2-ylbutan-1-amine.
| Compound Name | 4,4-difluoro-N-methyl-2-propan-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 134163261 |
| Molecular Formula | C8H17F2N |
| Molecular Weight | 165.23 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | 4,4-difluoro-N-methyl-2-propan-2-ylbutan-1-amine |
| SMILES | CNCC(CC(F)F)C(C)C |
| InChI | InChI=1S/C8H17F2N/c1-6(2)7(5-11-3)4-8(9)10/h6-8,11H,4-5H2,1-3H3 |
| InChIKey | UCRWSIMVLZVEBA-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.23 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |